C34H33N2O6P — CID 68542936
bis[4-[1-[4-(prop-2-enoylamino)phenyl]ethyl]phenyl] hydrogen phosphate (PubChem CID 68542936) has the molecular formula C34H33N2O6P and a molecular weight of 596.62 g/mol. Its IUPAC name is bis[4-[1-[4-(prop-2-enoylamino)phenyl]ethyl]phenyl] hydrogen phosphate.
| Compound Name | bis[4-[1-[4-(prop-2-enoylamino)phenyl]ethyl]phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 68542936 |
| Molecular Formula | C34H33N2O6P |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | bis[4-[1-[4-(prop-2-enoylamino)phenyl]ethyl]phenyl] hydrogen phosphate |
| SMILES | C=CC(=O)Nc1ccc(C(C)c2ccc(OP(=O)(O)Oc3ccc(C(C)c4ccc(NC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H33N2O6P/c1-5-33(37)35-29-15-7-25(8-16-29)23(3)27-11-19-31(20-12-27)41-43(39,40)42-32-21-13-28(14-22-32)24(4)26-9-17-30(18-10-26)36-34(38)6-2/h5-24H,1-2H2,3-4H3,(H,35,37)(H,36,38)(H,39,40) |
| InChIKey | DQMDSRAOHXQLGQ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|