C18H17N2O6P — CID 68547642
bis[2-(prop-2-enoylamino)phenyl] hydrogen phosphate (PubChem CID 68547642) has the molecular formula C18H17N2O6P and a molecular weight of 388.32 g/mol. Its IUPAC name is bis[2-(prop-2-enoylamino)phenyl] hydrogen phosphate.
| Compound Name | bis[2-(prop-2-enoylamino)phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 68547642 |
| Molecular Formula | C18H17N2O6P |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | bis[2-(prop-2-enoylamino)phenyl] hydrogen phosphate |
| SMILES | C=CC(=O)Nc1ccccc1OP(=O)(O)Oc1ccccc1NC(=O)C=C |
| InChI | InChI=1S/C18H17N2O6P/c1-3-17(21)19-13-9-5-7-11-15(13)25-27(23,24)26-16-12-8-6-10-14(16)20-18(22)4-2/h3-12H,1-2H2,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | IIWHTCAHTNKQRN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|