C17H15F2NO2 — CID 135302300
N-[4-[4-(1,1-difluoroethyl)phenoxy]phenyl]prop-2-enamide (PubChem CID 135302300) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is N-[4-[4-(1,1-difluoroethyl)phenoxy]phenyl]prop-2-enamide.
| Compound Name | N-[4-[4-(1,1-difluoroethyl)phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135302300 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[4-[4-(1,1-difluoroethyl)phenoxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Oc2ccc(C(C)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H15F2NO2/c1-3-16(21)20-13-6-10-15(11-7-13)22-14-8-4-12(5-9-14)17(2,18)19/h3-11H,1H2,2H3,(H,20,21) |
| InChIKey | ZTENZDFKITYHJM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|