C22H23N2O4P — CID 154068458
[4-(2-amino-2-imino-1,1-diphenylethyl)phenyl] dimethyl phosphate (PubChem CID 154068458) has the molecular formula C22H23N2O4P and a molecular weight of 410.41 g/mol. Its IUPAC name is [4-(2-amino-2-imino-1,1-diphenylethyl)phenyl] dimethyl phosphate.
| Compound Name | [4-(2-amino-2-imino-1,1-diphenylethyl)phenyl] dimethyl phosphate |
|---|---|
| PubChem CID | 154068458 |
| Molecular Formula | C22H23N2O4P |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [4-(2-amino-2-imino-1,1-diphenylethyl)phenyl] dimethyl phosphate |
| SMILES | [H]/N=C(\N)C(c1ccccc1)(c1ccccc1)c1ccc(OP(=O)(OC)OC)cc1 |
| InChI | InChI=1S/C22H23N2O4P/c1-26-29(25,27-2)28-20-15-13-19(14-16-20)22(21(23)24,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16H,1-2H3,(H3,23,24) |
| InChIKey | KXTMSWJERRQHKK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|