C22H33O3P — CID 168985818
1-[2-(4-dimethylphosphoryloxyphenyl)propan-2-yl]-4-propan-2-yloxybenzene;ethane (PubChem CID 168985818) has the molecular formula C22H33O3P and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-[2-(4-dimethylphosphoryloxyphenyl)propan-2-yl]-4-propan-2-yloxybenzene;ethane.
| Compound Name | 1-[2-(4-dimethylphosphoryloxyphenyl)propan-2-yl]-4-propan-2-yloxybenzene;ethane |
|---|---|
| PubChem CID | 168985818 |
| Molecular Formula | C22H33O3P |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-[2-(4-dimethylphosphoryloxyphenyl)propan-2-yl]-4-propan-2-yloxybenzene;ethane |
| SMILES | CC.CC(C)Oc1ccc(C(C)(C)c2ccc(OP(C)(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H27O3P.C2H6/c1-15(2)22-18-11-7-16(8-12-18)20(3,4)17-9-13-19(14-10-17)23-24(5,6)21;1-2/h7-15H,1-6H3;1-2H3 |
| InChIKey | OLLZIZKDXWYCNS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|