C13H20NO5PS — CID 175221165
[2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylcarbamic acid (PubChem CID 175221165) has the molecular formula C13H20NO5PS and a molecular weight of 333.35 g/mol. Its IUPAC name is [2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylcarbamic acid.
| Compound Name | [2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 175221165 |
| Molecular Formula | C13H20NO5PS |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]methylcarbamic acid |
| SMILES | CCCSP(=O)(OCC)Oc1ccccc1CNC(=O)O |
| InChI | InChI=1S/C13H20NO5PS/c1-3-9-21-20(17,18-4-2)19-12-8-6-5-7-11(12)10-14-13(15)16/h5-8,14H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | RRDMPHRNEYNCEU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|