C14H23O3PS2 — CID 21432667
5-[ethoxy(propylsulfanyl)phosphoryl]oxy-1,3-dimethyl-2-methylsulfanylbenzene (PubChem CID 21432667) has the molecular formula C14H23O3PS2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 5-[ethoxy(propylsulfanyl)phosphoryl]oxy-1,3-dimethyl-2-methylsulfanylbenzene.
| Compound Name | 5-[ethoxy(propylsulfanyl)phosphoryl]oxy-1,3-dimethyl-2-methylsulfanylbenzene |
|---|---|
| PubChem CID | 21432667 |
| Molecular Formula | C14H23O3PS2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-[ethoxy(propylsulfanyl)phosphoryl]oxy-1,3-dimethyl-2-methylsulfanylbenzene |
| SMILES | CCCSP(=O)(OCC)Oc1cc(C)c(SC)c(C)c1 |
| InChI | InChI=1S/C14H23O3PS2/c1-6-8-20-18(15,16-7-2)17-13-9-11(3)14(19-5)12(4)10-13/h9-10H,6-8H2,1-5H3 |
| InChIKey | RODPVHNNSHRBIZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|