C17H20ClO4PS2 — CID 12941004
1-(4-chlorophenyl)sulfinyl-4-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene (PubChem CID 12941004) has the molecular formula C17H20ClO4PS2 and a molecular weight of 418.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfinyl-4-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene.
| Compound Name | 1-(4-chlorophenyl)sulfinyl-4-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 12941004 |
| Molecular Formula | C17H20ClO4PS2 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 1-(4-chlorophenyl)sulfinyl-4-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(S(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H20ClO4PS2/c1-3-13-24-23(19,21-4-2)22-15-7-11-17(12-8-15)25(20)16-9-5-14(18)6-10-16/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | CIIWJWDRHUQKRW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|