C11H15BrClO3PS — CID 155289976
1-bromo-3-chloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene (PubChem CID 155289976) has the molecular formula C11H15BrClO3PS and a molecular weight of 373.64 g/mol. Its IUPAC name is 1-bromo-3-chloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene.
| Compound Name | 1-bromo-3-chloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 155289976 |
| Molecular Formula | C11H15BrClO3PS |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 1-bromo-3-chloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene |
| SMILES | CCCSP(=O)(OCC)Oc1c(Cl)cccc1Br |
| InChI | InChI=1S/C11H15BrClO3PS/c1-3-8-18-17(14,15-4-2)16-11-9(12)6-5-7-10(11)13/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | RCXAZVCZTUTDAI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|