C15H23O4PS — CID 13420482
7-[ethoxy(propylsulfanyl)phosphoryl]oxy-2,2-dimethyl-3H-1-benzofuran (PubChem CID 13420482) has the molecular formula C15H23O4PS and a molecular weight of 330.39 g/mol. Its IUPAC name is 7-[ethoxy(propylsulfanyl)phosphoryl]oxy-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 7-[ethoxy(propylsulfanyl)phosphoryl]oxy-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 13420482 |
| Molecular Formula | C15H23O4PS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 7-[ethoxy(propylsulfanyl)phosphoryl]oxy-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CCCSP(=O)(OCC)Oc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C15H23O4PS/c1-5-10-21-20(16,17-6-2)19-13-9-7-8-12-11-15(3,4)18-14(12)13/h7-9H,5-6,10-11H2,1-4H3 |
| InChIKey | NZGKBCVXHRLOOC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|