C25H27N2O6PS — CID 54543246
(2,2-dimethyl-3H-1-benzofuran-7-yl) N-[diphenoxyphosphoryl(methyl)amino]sulfanyl-N-methylcarbamate (PubChem CID 54543246) has the molecular formula C25H27N2O6PS and a molecular weight of 514.54 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[diphenoxyphosphoryl(methyl)amino]sulfanyl-N-methylcarbamate.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[diphenoxyphosphoryl(methyl)amino]sulfanyl-N-methylcarbamate |
|---|---|
| PubChem CID | 54543246 |
| Molecular Formula | C25H27N2O6PS |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[diphenoxyphosphoryl(methyl)amino]sulfanyl-N-methylcarbamate |
| SMILES | CN(SN(C)P(=O)(Oc1ccccc1)Oc1ccccc1)C(=O)Oc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C25H27N2O6PS/c1-25(2)18-19-12-11-17-22(23(19)31-25)30-24(28)26(3)35-27(4)34(29,32-20-13-7-5-8-14-20)33-21-15-9-6-10-16-21/h5-17H,18H2,1-4H3 |
| InChIKey | ZESIYAKVWUPJHM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|