C19H19NO5S — CID 23620785
(2,2-dimethyl-3H-1-benzofuran-7-yl) N-(1,3-benzodioxol-5-ylsulfanyl)-N-methylcarbamate (PubChem CID 23620785) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(1,3-benzodioxol-5-ylsulfanyl)-N-methylcarbamate.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(1,3-benzodioxol-5-ylsulfanyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 23620785 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(1,3-benzodioxol-5-ylsulfanyl)-N-methylcarbamate |
| SMILES | CN(Sc1ccc2c(c1)OCO2)C(=O)Oc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C19H19NO5S/c1-19(2)10-12-5-4-6-15(17(12)25-19)24-18(21)20(3)26-13-7-8-14-16(9-13)23-11-22-14/h4-9H,10-11H2,1-3H3 |
| InChIKey | ZPXZBKIORGYMBT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|