C21H29N5O7S — CID 54183278
(2,2-dimethyl-3H-1-benzofuran-7-yl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate (PubChem CID 54183278) has the molecular formula C21H29N5O7S and a molecular weight of 495.56 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate |
|---|---|
| PubChem CID | 54183278 |
| Molecular Formula | C21H29N5O7S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[[[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino]oxycarbonyl-methylamino]sulfanyl-N-methylcarbamate |
| SMILES | CON=C(C)C(=NOC(=O)N(C)SN(C)C(=O)Oc1cccc2c1OC(C)(C)C2)C(=O)N(C)C |
| InChI | InChI=1S/C21H29N5O7S/c1-13(22-30-8)16(18(27)24(4)5)23-33-20(29)26(7)34-25(6)19(28)31-15-11-9-10-14-12-21(2,3)32-17(14)15/h9-11H,12H2,1-8H3 |
| InChIKey | PDJHIDPHJDOGAI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 122.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|