C14H19N3O7S — CID 54543729
(2,2-dimethyl-3H-1-benzofuran-7-yl) N-[methoxy(sulfamoyl)carbamoyl]-N-methylcarbamate (PubChem CID 54543729) has the molecular formula C14H19N3O7S and a molecular weight of 373.39 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[methoxy(sulfamoyl)carbamoyl]-N-methylcarbamate.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[methoxy(sulfamoyl)carbamoyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 54543729 |
| Molecular Formula | C14H19N3O7S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-[methoxy(sulfamoyl)carbamoyl]-N-methylcarbamate |
| SMILES | CON(C(=O)N(C)C(=O)Oc1cccc2c1OC(C)(C)C2)S(N)(=O)=O |
| InChI | InChI=1S/C14H19N3O7S/c1-14(2)8-9-6-5-7-10(11(9)24-14)23-13(19)16(3)12(18)17(22-4)25(15,20)21/h5-7H,8H2,1-4H3,(H2,15,20,21) |
| InChIKey | ZFBQETCEAPBDFV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|