C23H29NO3S — CID 23620789
(2,2-dimethyl-3H-1-benzofuran-7-yl) N-(4-tert-butyl-2-methylphenyl)sulfanyl-N-methylcarbamate (PubChem CID 23620789) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(4-tert-butyl-2-methylphenyl)sulfanyl-N-methylcarbamate.
| Compound Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(4-tert-butyl-2-methylphenyl)sulfanyl-N-methylcarbamate |
|---|---|
| PubChem CID | 23620789 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(4-tert-butyl-2-methylphenyl)sulfanyl-N-methylcarbamate |
| SMILES | Cc1cc(C(C)(C)C)ccc1SN(C)C(=O)Oc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C23H29NO3S/c1-15-13-17(22(2,3)4)11-12-19(15)28-24(7)21(25)26-18-10-8-9-16-14-23(5,6)27-20(16)18/h8-13H,14H2,1-7H3 |
| InChIKey | YMUUPTUOUHGTST-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|