C18H19NO4S — CID 21481699
(2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-(4-methylphenyl)sulfanylcarbamate (PubChem CID 21481699) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-(4-methylphenyl)sulfanylcarbamate.
| Compound Name | (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-(4-methylphenyl)sulfanylcarbamate |
|---|---|
| PubChem CID | 21481699 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (2,2-dimethyl-1,3-benzodioxol-4-yl) N-methyl-N-(4-methylphenyl)sulfanylcarbamate |
| SMILES | Cc1ccc(SN(C)C(=O)Oc2cccc3c2OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-12-8-10-13(11-9-12)24-19(4)17(20)21-14-6-5-7-15-16(14)23-18(2,3)22-15/h5-11H,1-4H3 |
| InChIKey | QVAJYNCUHHTQGM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|