C11H15Cl2O3PS — CID 21489075
1,4-dichloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene (PubChem CID 21489075) has the molecular formula C11H15Cl2O3PS and a molecular weight of 329.19 g/mol. Its IUPAC name is 1,4-dichloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene.
| Compound Name | 1,4-dichloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 21489075 |
| Molecular Formula | C11H15Cl2O3PS |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 1,4-dichloro-2-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene |
| SMILES | CCCSP(=O)(OCC)Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2O3PS/c1-3-7-18-17(14,15-4-2)16-11-8-9(12)5-6-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | CQAMNXBOSFKWPM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|