C8H9Cl2O3P — CID 165355272
(2,5-dichlorophenyl)-ethoxyphosphinic acid (PubChem CID 165355272) has the molecular formula C8H9Cl2O3P and a molecular weight of 255.04 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-ethoxyphosphinic acid.
| Compound Name | (2,5-dichlorophenyl)-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 165355272 |
| Molecular Formula | C8H9Cl2O3P |
| Molecular Weight | 255.04 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | (2,5-dichlorophenyl)-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H9Cl2O3P/c1-2-13-14(11,12)8-5-6(9)3-4-7(8)10/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | DFGQWDBJNKBRKG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.04 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|