C11H14Cl2NO4P — CID 11110183
(NE)-N-[(2,4-dichlorophenyl)-diethoxyphosphorylmethylidene]hydroxylamine (PubChem CID 11110183) has the molecular formula C11H14Cl2NO4P and a molecular weight of 326.12 g/mol. Its IUPAC name is (NE)-N-[(2,4-dichlorophenyl)-diethoxyphosphorylmethylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2,4-dichlorophenyl)-diethoxyphosphorylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 11110183 |
| Molecular Formula | C11H14Cl2NO4P |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | (NE)-N-[(2,4-dichlorophenyl)-diethoxyphosphorylmethylidene]hydroxylamine |
| SMILES | CCOP(=O)(OCC)/C(=N/O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2NO4P/c1-3-17-19(16,18-4-2)11(14-15)9-6-5-8(12)7-10(9)13/h5-7,15H,3-4H2,1-2H3/b14-11+ |
| InChIKey | VJIHKUQMHNFEIT-SDNWHVSQSA-N |
| XLogP | 4.40 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|