C8H8Cl3O3P — CID 13392474
2,4-dichloro-1-[chloro(ethoxy)phosphoryl]oxybenzene (PubChem CID 13392474) has the molecular formula C8H8Cl3O3P and a molecular weight of 289.48 g/mol. Its IUPAC name is 2,4-dichloro-1-[chloro(ethoxy)phosphoryl]oxybenzene.
| Compound Name | 2,4-dichloro-1-[chloro(ethoxy)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 13392474 |
| Molecular Formula | C8H8Cl3O3P |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 287.93 |
| IUPAC Name | 2,4-dichloro-1-[chloro(ethoxy)phosphoryl]oxybenzene |
| SMILES | CCOP(=O)(Cl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl3O3P/c1-2-13-15(11,12)14-8-4-3-6(9)5-7(8)10/h3-5H,2H2,1H3 |
| InChIKey | OSVNMGNOQIPSIL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|