C11H13Cl2O6P — CID 134828232
ethyl 2-[(2,4-dichlorophenoxy)-methoxyphosphoryl]oxyacetate (PubChem CID 134828232) has the molecular formula C11H13Cl2O6P and a molecular weight of 343.10 g/mol. Its IUPAC name is ethyl 2-[(2,4-dichlorophenoxy)-methoxyphosphoryl]oxyacetate.
| Compound Name | ethyl 2-[(2,4-dichlorophenoxy)-methoxyphosphoryl]oxyacetate |
|---|---|
| PubChem CID | 134828232 |
| Molecular Formula | C11H13Cl2O6P |
| Molecular Weight | 343.10 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | ethyl 2-[(2,4-dichlorophenoxy)-methoxyphosphoryl]oxyacetate |
| SMILES | CCOC(=O)COP(=O)(OC)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2O6P/c1-3-17-11(14)7-18-20(15,16-2)19-10-5-4-8(12)6-9(10)13/h4-6H,3,7H2,1-2H3 |
| InChIKey | LTODFNZGDZVSHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|