C9H11Cl2O3PS — CID 100976953
(2,4-dichlorophenoxy)-ethoxy-methoxy-sulfanylidene-λ5-phosphane (PubChem CID 100976953) has the molecular formula C9H11Cl2O3PS and a molecular weight of 301.13 g/mol. Its IUPAC name is (2,4-dichlorophenoxy)-ethoxy-methoxy-sulfanylidene-λ5-phosphane.
| Compound Name | (2,4-dichlorophenoxy)-ethoxy-methoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 100976953 |
| Molecular Formula | C9H11Cl2O3PS |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | (2,4-dichlorophenoxy)-ethoxy-methoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OC)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2O3PS/c1-3-13-15(16,12-2)14-9-5-4-7(10)6-8(9)11/h4-6H,3H2,1-2H3 |
| InChIKey | CVTBUUGRPQLARD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|