C12H21Cl2N2O3PS — CID 70262285
2-aminoethanol;N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine (PubChem CID 70262285) has the molecular formula C12H21Cl2N2O3PS and a molecular weight of 375.26 g/mol. Its IUPAC name is 2-aminoethanol;N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine.
| Compound Name | 2-aminoethanol;N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine |
|---|---|
| PubChem CID | 70262285 |
| Molecular Formula | C12H21Cl2N2O3PS |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 2-aminoethanol;N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine |
| SMILES | COP(=S)(NC(C)C)Oc1ccc(Cl)cc1Cl.NCCO |
| InChI | InChI=1S/C10H14Cl2NO2PS.C2H7NO/c1-7(2)13-16(17,14-3)15-10-5-4-8(11)6-9(10)12;3-1-2-4/h4-7H,1-3H3,(H,13,17);4H,1-3H2 |
| InChIKey | UBXTWBOPUDIIFR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|