C10H14Cl2NO3PS — CID 88829832
N-[(2,4-dichlorophenoxy)-hydroxyphosphinothioyl]oxy-N-methylpropan-2-amine (PubChem CID 88829832) has the molecular formula C10H14Cl2NO3PS and a molecular weight of 330.17 g/mol. Its IUPAC name is N-[(2,4-dichlorophenoxy)-hydroxyphosphinothioyl]oxy-N-methylpropan-2-amine.
| Compound Name | N-[(2,4-dichlorophenoxy)-hydroxyphosphinothioyl]oxy-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 88829832 |
| Molecular Formula | C10H14Cl2NO3PS |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | N-[(2,4-dichlorophenoxy)-hydroxyphosphinothioyl]oxy-N-methylpropan-2-amine |
| SMILES | CC(C)N(C)OP(O)(=S)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2NO3PS/c1-7(2)13(3)16-17(14,18)15-10-5-4-8(11)6-9(10)12/h4-7H,1-3H3,(H,14,18) |
| InChIKey | XWHZEOUFNNIYFO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|