C10H14Cl2NO2PS — CID 9299
N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine (PubChem CID 9299) has the molecular formula C10H14Cl2NO2PS and a molecular weight of 314.17 g/mol. Its IUPAC name is N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine.
| Compound Name | N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine |
|---|---|
| PubChem CID | 9299 |
| Molecular Formula | C10H14Cl2NO2PS |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-[(2,4-dichlorophenoxy)-methoxyphosphinothioyl]propan-2-amine |
| SMILES | COP(=S)(NC(C)C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2NO2PS/c1-7(2)13-16(17,14-3)15-10-5-4-8(11)6-9(10)12/h4-7H,1-3H3,(H,13,17) |
| InChIKey | PJFGPJQBWSEWKX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|