C10H11Cl2N2OPS2 — CID 12557316
N-[(2,4-dichlorophenoxy)-methylphosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 12557316) has the molecular formula C10H11Cl2N2OPS2 and a molecular weight of 341.23 g/mol. Its IUPAC name is N-[(2,4-dichlorophenoxy)-methylphosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-[(2,4-dichlorophenoxy)-methylphosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 12557316 |
| Molecular Formula | C10H11Cl2N2OPS2 |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | N-[(2,4-dichlorophenoxy)-methylphosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CP(=S)(NC1=NCCS1)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N2OPS2/c1-16(17,14-10-13-4-5-18-10)15-9-3-2-7(11)6-8(9)12/h2-3,6H,4-5H2,1H3,(H,13,14,17) |
| InChIKey | IYDOGZZALLYEGC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|