C10H7Cl2NOS2 — CID 805258
S-(4,5-dihydro-1,3-thiazol-2-yl) 2,4-dichlorobenzenecarbothioate (PubChem CID 805258) has the molecular formula C10H7Cl2NOS2 and a molecular weight of 292.21 g/mol. Its IUPAC name is S-(4,5-dihydro-1,3-thiazol-2-yl) 2,4-dichlorobenzenecarbothioate.
| Compound Name | S-(4,5-dihydro-1,3-thiazol-2-yl) 2,4-dichlorobenzenecarbothioate |
|---|---|
| PubChem CID | 805258 |
| Molecular Formula | C10H7Cl2NOS2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | S-(4,5-dihydro-1,3-thiazol-2-yl) 2,4-dichlorobenzenecarbothioate |
| SMILES | O=C(SC1=NCCS1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl2NOS2/c11-6-1-2-7(8(12)5-6)9(14)16-10-13-3-4-15-10/h1-2,5H,3-4H2 |
| InChIKey | UMWVUVSDDUHJEA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|