C10H10BrClN2S — CID 81275151
N-(2-bromo-5-chlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 81275151) has the molecular formula C10H10BrClN2S and a molecular weight of 305.63 g/mol. Its IUPAC name is N-(2-bromo-5-chlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(2-bromo-5-chlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 81275151 |
| Molecular Formula | C10H10BrClN2S |
| Molecular Weight | 305.63 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | N-(2-bromo-5-chlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | Clc1ccc(Br)c(NC2=NCCCS2)c1 |
| InChI | InChI=1S/C10H10BrClN2S/c11-8-3-2-7(12)6-9(8)14-10-13-4-1-5-15-10/h2-3,6H,1,4-5H2,(H,13,14) |
| InChIKey | CMCGDETZKFDTIB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |