C10H13N2OPS2 — CID 3517065
N-[methyl(phenoxy)phosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 3517065) has the molecular formula C10H13N2OPS2 and a molecular weight of 272.33 g/mol. Its IUPAC name is N-[methyl(phenoxy)phosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-[methyl(phenoxy)phosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3517065 |
| Molecular Formula | C10H13N2OPS2 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-[methyl(phenoxy)phosphinothioyl]-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CP(=S)(NC1=NCCS1)Oc1ccccc1 |
| InChI | InChI=1S/C10H13N2OPS2/c1-14(15,12-10-11-7-8-16-10)13-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,11,12,15) |
| InChIKey | AKPVEGCSOKJUCN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|