C11H14N3O3PS — CID 23269356
1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphoryl]urea (PubChem CID 23269356) has the molecular formula C11H14N3O3PS and a molecular weight of 299.29 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphoryl]urea.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphoryl]urea |
|---|---|
| PubChem CID | 23269356 |
| Molecular Formula | C11H14N3O3PS |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphoryl]urea |
| SMILES | CP(=O)(NC(=O)NC1=NCCS1)Oc1ccccc1 |
| InChI | InChI=1S/C11H14N3O3PS/c1-18(16,17-9-5-3-2-4-6-9)14-10(15)13-11-12-7-8-19-11/h2-6H,7-8H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | SNMOIVDHXKGXDP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|