C14H13N3OS — CID 108884683
1-(4,5-dihydro-1,3-thiazol-2-yl)-3-naphthalen-1-ylurea (PubChem CID 108884683) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-naphthalen-1-ylurea.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 108884683 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-naphthalen-1-ylurea |
| SMILES | O=C(NC1=NCCS1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C14H13N3OS/c18-13(17-14-15-8-9-19-14)16-12-7-3-5-10-4-1-2-6-11(10)12/h1-7H,8-9H2,(H2,15,16,17,18) |
| InChIKey | PEEREBAJNIJNJZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |