C11H14N3O2PS2 — CID 23269357
1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphinothioyl]urea (PubChem CID 23269357) has the molecular formula C11H14N3O2PS2 and a molecular weight of 315.36 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphinothioyl]urea.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphinothioyl]urea |
|---|---|
| PubChem CID | 23269357 |
| Molecular Formula | C11H14N3O2PS2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[methyl(phenoxy)phosphinothioyl]urea |
| SMILES | CP(=S)(NC(=O)NC1=NCCS1)Oc1ccccc1 |
| InChI | InChI=1S/C11H14N3O2PS2/c1-17(18,16-9-5-3-2-4-6-9)14-10(15)13-11-12-7-8-19-11/h2-6H,7-8H2,1H3,(H2,12,13,14,15,18) |
| InChIKey | HRLSQWIOMBTELV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|