C12H15N3O2S — CID 108893037
1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(4-methylphenoxy)methyl]urea (PubChem CID 108893037) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(4-methylphenoxy)methyl]urea.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(4-methylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108893037 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(4-methylphenoxy)methyl]urea |
| SMILES | Cc1ccc(OCNC(=O)NC2=NCCS2)cc1 |
| InChI | InChI=1S/C12H15N3O2S/c1-9-2-4-10(5-3-9)17-8-14-11(16)15-12-13-6-7-18-12/h2-5H,6-8H2,1H3,(H2,13,14,15,16) |
| InChIKey | RMRJRDZVOMVHAR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|