C13H17N3O2S — CID 108870790
1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(2,4-dimethylphenoxy)methyl]urea (PubChem CID 108870790) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(2,4-dimethylphenoxy)methyl]urea.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(2,4-dimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108870790 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-[(2,4-dimethylphenoxy)methyl]urea |
| SMILES | Cc1ccc(OCNC(=O)NC2=NCCS2)c(C)c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-9-3-4-11(10(2)7-9)18-8-15-12(17)16-13-14-5-6-19-13/h3-4,7H,5-6,8H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | ZHEYYTXLCWJXNE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|