C12H12ClN3O2S — CID 108524105
N-(4-chloro-2-methylphenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide (PubChem CID 108524105) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 108524105 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C12H12ClN3O2S/c1-7-6-8(13)2-3-9(7)15-10(17)11(18)16-12-14-4-5-19-12/h2-3,6H,4-5H2,1H3,(H,15,17)(H,14,16,18) |
| InChIKey | VTVWWRDQNRZKAC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|