C11H8F3N3O2S — CID 108530808
N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,3,4-trifluorophenyl)oxamide (PubChem CID 108530808) has the molecular formula C11H8F3N3O2S and a molecular weight of 303.27 g/mol. Its IUPAC name is N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,3,4-trifluorophenyl)oxamide.
| Compound Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,3,4-trifluorophenyl)oxamide |
|---|---|
| PubChem CID | 108530808 |
| Molecular Formula | C11H8F3N3O2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2,3,4-trifluorophenyl)oxamide |
| SMILES | O=C(NC1=NCCS1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H8F3N3O2S/c12-5-1-2-6(8(14)7(5)13)16-9(18)10(19)17-11-15-3-4-20-11/h1-2H,3-4H2,(H,16,18)(H,15,17,19) |
| InChIKey | YLDWQKRFTSVDCH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|