C8H8N4O2S2 — CID 108520051
N-(4,5-dihydro-1,3-thiazol-2-yl)-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 108520051) has the molecular formula C8H8N4O2S2 and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-N'-(1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-N'-(1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 108520051 |
| Molecular Formula | C8H8N4O2S2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(NC1=NCCS1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H8N4O2S2/c13-5(11-7-9-1-3-15-7)6(14)12-8-10-2-4-16-8/h1,3H,2,4H2,(H,9,11,13)(H,10,12,14) |
| InChIKey | COPOVXWGOGZEDK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|