C11H10BrN3O2S — CID 108530774
N-(2-bromophenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide (PubChem CID 108530774) has the molecular formula C11H10BrN3O2S and a molecular weight of 328.19 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(2-bromophenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 108530774 |
| Molecular Formula | C11H10BrN3O2S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | N-(2-bromophenyl)-N'-(4,5-dihydro-1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(NC1=NCCS1)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C11H10BrN3O2S/c12-7-3-1-2-4-8(7)14-9(16)10(17)15-11-13-5-6-18-11/h1-4H,5-6H2,(H,14,16)(H,13,15,17) |
| InChIKey | HZECEJYOLZVDJA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|