C11H12N4O2S — CID 108530798
N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(4-methyl-2-pyridinyl)oxamide (PubChem CID 108530798) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(4-methyl-2-pyridinyl)oxamide.
| Compound Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(4-methyl-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 108530798 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(4-methyl-2-pyridinyl)oxamide |
| SMILES | Cc1ccnc(NC(=O)C(=O)NC2=NCCS2)c1 |
| InChI | InChI=1S/C11H12N4O2S/c1-7-2-3-12-8(6-7)14-9(16)10(17)15-11-13-4-5-18-11/h2-3,6H,4-5H2,1H3,(H,12,14,16)(H,13,15,17) |
| InChIKey | NXHUBOAPIHDJCW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|