C15H18N4O3S — CID 108527494
N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2-morpholin-4-ylphenyl)oxamide (PubChem CID 108527494) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2-morpholin-4-ylphenyl)oxamide.
| Compound Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108527494 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N-(2-morpholin-4-ylphenyl)oxamide |
| SMILES | O=C(NC1=NCCS1)C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C15H18N4O3S/c20-13(14(21)18-15-16-5-10-23-15)17-11-3-1-2-4-12(11)19-6-8-22-9-7-19/h1-4H,5-10H2,(H,17,20)(H,16,18,21) |
| InChIKey | JUTPUZBWFYNXNB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|