C8H7N3O2S2 — CID 143406687
1,3-thiazol-2-ylmethyl N-(1,3-thiazol-2-yl)carbamate (PubChem CID 143406687) has the molecular formula C8H7N3O2S2 and a molecular weight of 241.30 g/mol. Its IUPAC name is 1,3-thiazol-2-ylmethyl N-(1,3-thiazol-2-yl)carbamate.
| Compound Name | 1,3-thiazol-2-ylmethyl N-(1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 143406687 |
| Molecular Formula | C8H7N3O2S2 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 1,3-thiazol-2-ylmethyl N-(1,3-thiazol-2-yl)carbamate |
| SMILES | O=C(Nc1nccs1)OCc1nccs1 |
| InChI | InChI=1S/C8H7N3O2S2/c12-8(11-7-10-2-4-15-7)13-5-6-9-1-3-14-6/h1-4H,5H2,(H,10,11,12) |
| InChIKey | LFXLDESLXXOHEL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |