C9H10N2O3S — CID 2106440
ethyl (E)-4-oxo-4-(1,3-thiazol-2-ylamino)but-2-enoate (PubChem CID 2106440) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is ethyl (E)-4-oxo-4-(1,3-thiazol-2-ylamino)but-2-enoate.
| Compound Name | ethyl (E)-4-oxo-4-(1,3-thiazol-2-ylamino)but-2-enoate |
|---|---|
| PubChem CID | 2106440 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | ethyl (E)-4-oxo-4-(1,3-thiazol-2-ylamino)but-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H10N2O3S/c1-2-14-8(13)4-3-7(12)11-9-10-5-6-15-9/h3-6H,2H2,1H3,(H,10,11,12)/b4-3+ |
| InChIKey | XEPOQFCTWLPJAU-ONEGZZNKSA-N |
| XLogP | 1.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|