C8H11N3OS — CID 131274999
(E)-3-(ethylamino)-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 131274999) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is (E)-3-(ethylamino)-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(ethylamino)-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 131274999 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (E)-3-(ethylamino)-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCN/C=C/C(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H11N3OS/c1-2-9-4-3-7(12)11-8-10-5-6-13-8/h3-6,9H,2H2,1H3,(H,10,11,12)/b4-3+ |
| InChIKey | XNRMYVCJCFNATA-ONEGZZNKSA-N |
| XLogP | 1.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|