C8H7N3O2S2 — CID 121248864
(5-aminothiophen-3-yl) N-(1,3-thiazol-2-yl)carbamate (PubChem CID 121248864) has the molecular formula C8H7N3O2S2 and a molecular weight of 241.30 g/mol. Its IUPAC name is (5-aminothiophen-3-yl) N-(1,3-thiazol-2-yl)carbamate.
| Compound Name | (5-aminothiophen-3-yl) N-(1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 121248864 |
| Molecular Formula | C8H7N3O2S2 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | (5-aminothiophen-3-yl) N-(1,3-thiazol-2-yl)carbamate |
| SMILES | Nc1cc(OC(=O)Nc2nccs2)cs1 |
| InChI | InChI=1S/C8H7N3O2S2/c9-6-3-5(4-15-6)13-8(12)11-7-10-1-2-14-7/h1-4H,9H2,(H,10,11,12) |
| InChIKey | WKRHGQKWLNKNOZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |