C11H9F3N2OS2 — CID 9454427
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9454427) has the molecular formula C11H9F3N2OS2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9454427 |
| Molecular Formula | C11H9F3N2OS2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSC1=NCCS1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H9F3N2OS2/c12-6-1-2-7(10(14)9(6)13)16-8(17)5-19-11-15-3-4-18-11/h1-2H,3-5H2,(H,16,17) |
| InChIKey | ASMKVBUQUVOPSI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|