C11H15Cl2NO — CID 62461001
4-(2,4-dichlorophenoxy)pentan-1-amine (PubChem CID 62461001) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)pentan-1-amine.
| Compound Name | 4-(2,4-dichlorophenoxy)pentan-1-amine |
|---|---|
| PubChem CID | 62461001 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)pentan-1-amine |
| SMILES | CC(CCCN)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2NO/c1-8(3-2-6-14)15-11-5-4-9(12)7-10(11)13/h4-5,7-8H,2-3,6,14H2,1H3 |
| InChIKey | ZCKOGVOPISFATA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |