C9H10Cl3O3PSSi — CID 87676034
CID 87676034 (PubChem CID 87676034) has the molecular formula C9H10Cl3O3PSSi and a molecular weight of 363.66 g/mol.
| Compound Name | CID 87676034 |
|---|---|
| PubChem CID | 87676034 |
| Molecular Formula | C9H10Cl3O3PSSi |
| Molecular Weight | 363.66 g/mol |
| Exact Mass | 361.89 |
| IUPAC Name | — |
| SMILES | CCOP(=S)(OC)Oc1cc(Cl)c(Cl)cc1Cl.[Si] |
| InChI | InChI=1S/C9H10Cl3O3PS.Si/c1-3-14-16(17,13-2)15-9-5-7(11)6(10)4-8(9)12;/h4-5H,3H2,1-2H3; |
| InChIKey | SKKRWMMSONXHNX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|