C10H12Cl3O2PS — CID 9477
ethoxy-ethyl-sulfanylidene-(2,4,5-trichlorophenoxy)-lambda5-phosphane (PubChem CID 9477) has the molecular formula C10H12Cl3O2PS and a molecular weight of 333.60 g/mol. Its IUPAC name is ethoxy-ethyl-sulfanylidene-(2,4,5-trichlorophenoxy)-lambda5-phosphane.
| Compound Name | ethoxy-ethyl-sulfanylidene-(2,4,5-trichlorophenoxy)-lambda5-phosphane |
|---|---|
| PubChem CID | 9477 |
| Molecular Formula | C10H12Cl3O2PS |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | ethoxy-ethyl-sulfanylidene-(2,4,5-trichlorophenoxy)-lambda5-phosphane |
| SMILES | CCOP(=S)(CC)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl3O2PS/c1-3-14-16(17,4-2)15-10-6-8(12)7(11)5-9(10)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | ANIAQSUBRGXWLS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|