C13H17Cl3NO9PS — CID 175194272
diethoxy-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane;2,3-dihydroxybutanedioic acid (PubChem CID 175194272) has the molecular formula C13H17Cl3NO9PS and a molecular weight of 500.68 g/mol. Its IUPAC name is diethoxy-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane;2,3-dihydroxybutanedioic acid.
| Compound Name | diethoxy-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 175194272 |
| Molecular Formula | C13H17Cl3NO9PS |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 498.94 |
| IUPAC Name | diethoxy-sulfanylidene-[(3,5,6-trichloro-2-pyridinyl)oxy]-λ5-phosphane;2,3-dihydroxybutanedioic acid |
| SMILES | CCOP(=S)(OCC)Oc1nc(Cl)c(Cl)cc1Cl.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H11Cl3NO3PS.C4H6O6/c1-3-14-17(18,15-4-2)16-9-7(11)5-6(10)8(12)13-9;5-1(3(7)8)2(6)4(9)10/h5H,3-4H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | YRKQDUUOQLWPFY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|