C12H17Cl2N2O6PS — CID 71405901
(2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid (PubChem CID 71405901) has the molecular formula C12H17Cl2N2O6PS and a molecular weight of 419.22 g/mol. Its IUPAC name is (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 71405901 |
| Molecular Formula | C12H17Cl2N2O6PS |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | (2R)-2-amino-3-[(3,5-dichloro-6-diethoxyphosphoryloxy-2-pyridinyl)sulfanyl]propanoic acid |
| SMILES | CCOP(=O)(OCC)Oc1nc(SC[C@H](N)C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N2O6PS/c1-3-20-23(19,21-4-2)22-10-7(13)5-8(14)11(16-10)24-6-9(15)12(17)18/h5,9H,3-4,6,15H2,1-2H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | RJUONRGKXOXNBR-VIFPVBQESA-N |
| XLogP | 3.45 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|